C13H15N3O2 — CID 82571318
N'-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)propane-1,3-diamine (PubChem CID 82571318) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N'-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)propane-1,3-diamine.
| Compound Name | N'-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 82571318 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N'-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)propane-1,3-diamine |
| SMILES | NCCCNc1nccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C13H15N3O2/c14-3-1-4-15-13-10-7-12-11(17-8-18-12)6-9(10)2-5-16-13/h2,5-7H,1,3-4,8,14H2,(H,15,16) |
| InChIKey | VDLFBPCASIMPPP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|