C16H13N3O2 — CID 106537357
N-(pyridin-2-ylmethyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine (PubChem CID 106537357) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine.
| Compound Name | N-(pyridin-2-ylmethyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
|---|---|
| PubChem CID | 106537357 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
| SMILES | c1ccc(CNc2nccc3cc4c(cc23)OCO4)nc1 |
| InChI | InChI=1S/C16H13N3O2/c1-2-5-17-12(3-1)9-19-16-13-8-15-14(20-10-21-15)7-11(13)4-6-18-16/h1-8H,9-10H2,(H,18,19) |
| InChIKey | GQTIJCSWLYMALV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |