C15H15ClN2O2 — CID 106543011
N-[[1-(chloromethyl)cyclopropyl]methyl]-[1,3]dioxolo[4,5-g]isoquinolin-5-amine (PubChem CID 106543011) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopropyl]methyl]-[1,3]dioxolo[4,5-g]isoquinolin-5-amine.
| Compound Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
|---|---|
| PubChem CID | 106543011 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
| SMILES | ClCC1(CNc2nccc3cc4c(cc23)OCO4)CC1 |
| InChI | InChI=1S/C15H15ClN2O2/c16-7-15(2-3-15)8-18-14-11-6-13-12(19-9-20-13)5-10(11)1-4-17-14/h1,4-6H,2-3,7-9H2,(H,17,18) |
| InChIKey | OVKRDDUHKJQWDO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|