C14H16N2O3S — CID 106539645
N-(2-methylsulfinylpropyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine (PubChem CID 106539645) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(2-methylsulfinylpropyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine.
| Compound Name | N-(2-methylsulfinylpropyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
|---|---|
| PubChem CID | 106539645 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-(2-methylsulfinylpropyl)-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
| SMILES | CC(CNc1nccc2cc3c(cc12)OCO3)S(C)=O |
| InChI | InChI=1S/C14H16N2O3S/c1-9(20(2)17)7-16-14-11-6-13-12(18-8-19-13)5-10(11)3-4-15-14/h3-6,9H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | QIHMYCFSTBKTTA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |