C16H18N2O3 — CID 106538565
N-(oxan-3-yl)-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-amine (PubChem CID 106538565) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(oxan-3-yl)-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-amine.
| Compound Name | N-(oxan-3-yl)-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-amine |
|---|---|
| PubChem CID | 106538565 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-(oxan-3-yl)-2,3-dihydro-[1,4]dioxino[2,3-g]isoquinolin-6-amine |
| SMILES | c1cc2cc3c(cc2c(NC2CCCOC2)n1)OCCO3 |
| InChI | InChI=1S/C16H18N2O3/c1-2-12(10-19-5-1)18-16-13-9-15-14(20-6-7-21-15)8-11(13)3-4-17-16/h3-4,8-9,12H,1-2,5-7,10H2,(H,17,18) |
| InChIKey | VQZGHLSYROTWLT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |