C13H13N5O — CID 106538776
1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]isoquinolin-7-ol (PubChem CID 106538776) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]isoquinolin-7-ol.
| Compound Name | 1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]isoquinolin-7-ol |
|---|---|
| PubChem CID | 106538776 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-[2-(1H-1,2,4-triazol-5-yl)ethylamino]isoquinolin-7-ol |
| SMILES | Oc1ccc2ccnc(NCCc3ncn[nH]3)c2c1 |
| InChI | InChI=1S/C13H13N5O/c19-10-2-1-9-3-5-14-13(11(9)7-10)15-6-4-12-16-8-17-18-12/h1-3,5,7-8,19H,4,6H2,(H,14,15)(H,16,17,18) |
| InChIKey | XEABLQQARCWNBA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |