C9H10BrN5 — CID 64530464
3-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine (PubChem CID 64530464) has the molecular formula C9H10BrN5 and a molecular weight of 268.12 g/mol. Its IUPAC name is 3-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine.
| Compound Name | 3-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 64530464 |
| Molecular Formula | C9H10BrN5 |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 3-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]pyridin-2-amine |
| SMILES | Brc1cccnc1NCCc1ncn[nH]1 |
| InChI | InChI=1S/C9H10BrN5/c10-7-2-1-4-11-9(7)12-5-3-8-13-6-14-15-8/h1-2,4,6H,3,5H2,(H,11,12)(H,13,14,15) |
| InChIKey | TUBQZGRVYXSLDF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |