C11H14N6O — CID 64530064
2-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridine-3-carboxamide (PubChem CID 64530064) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridine-3-carboxamide.
| Compound Name | 2-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 64530064 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H14N6O/c12-10(18)8-3-1-5-13-11(8)14-6-2-4-9-15-7-16-17-9/h1,3,5,7H,2,4,6H2,(H2,12,18)(H,13,14)(H,15,16,17) |
| InChIKey | NSYWADQFVKVHKN-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|