C16H18N2O — CID 106177647
1-[2-(cyclopenten-1-yl)ethylamino]isoquinolin-7-ol (PubChem CID 106177647) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-[2-(cyclopenten-1-yl)ethylamino]isoquinolin-7-ol.
| Compound Name | 1-[2-(cyclopenten-1-yl)ethylamino]isoquinolin-7-ol |
|---|---|
| PubChem CID | 106177647 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-[2-(cyclopenten-1-yl)ethylamino]isoquinolin-7-ol |
| SMILES | Oc1ccc2ccnc(NCCC3=CCCC3)c2c1 |
| InChI | InChI=1S/C16H18N2O/c19-14-6-5-13-8-10-18-16(15(13)11-14)17-9-7-12-3-1-2-4-12/h3,5-6,8,10-11,19H,1-2,4,7,9H2,(H,17,18) |
| InChIKey | FPZPLYGWBGDKGX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|