C15H16ClN3 — CID 114156958
2-chloro-N-[2-(cyclopenten-1-yl)ethyl]quinazolin-4-amine (PubChem CID 114156958) has the molecular formula C15H16ClN3 and a molecular weight of 273.77 g/mol. Its IUPAC name is 2-chloro-N-[2-(cyclopenten-1-yl)ethyl]quinazolin-4-amine.
| Compound Name | 2-chloro-N-[2-(cyclopenten-1-yl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 114156958 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-chloro-N-[2-(cyclopenten-1-yl)ethyl]quinazolin-4-amine |
| SMILES | Clc1nc(NCCC2=CCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C15H16ClN3/c16-15-18-13-8-4-3-7-12(13)14(19-15)17-10-9-11-5-1-2-6-11/h3-5,7-8H,1-2,6,9-10H2,(H,17,18,19) |
| InChIKey | LUKVRVUBRVIJMP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|