C16H20ClN3S — CID 93214217
2-chloro-N-[2-(cyclohexen-1-yl)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 93214217) has the molecular formula C16H20ClN3S and a molecular weight of 321.88 g/mol. Its IUPAC name is 2-chloro-N-[2-(cyclohexen-1-yl)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[2-(cyclohexen-1-yl)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 93214217 |
| Molecular Formula | C16H20ClN3S |
| Molecular Weight | 321.88 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-chloro-N-[2-(cyclohexen-1-yl)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NCCC3=CCCCC3)nc(Cl)nc2s1 |
| InChI | InChI=1S/C16H20ClN3S/c1-2-12-10-13-14(19-16(17)20-15(13)21-12)18-9-8-11-6-4-3-5-7-11/h6,10H,2-5,7-9H2,1H3,(H,18,19,20) |
| InChIKey | HYPUAPWGDUMKBH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.88 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|