C15H22ClN3OS — CID 103321341
2-chloro-6-ethyl-N-[2-(3-methylbutoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103321341) has the molecular formula C15H22ClN3OS and a molecular weight of 327.88 g/mol. Its IUPAC name is 2-chloro-6-ethyl-N-[2-(3-methylbutoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-ethyl-N-[2-(3-methylbutoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103321341 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-chloro-6-ethyl-N-[2-(3-methylbutoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NCCOCCC(C)C)nc(Cl)nc2s1 |
| InChI | InChI=1S/C15H22ClN3OS/c1-4-11-9-12-13(18-15(16)19-14(12)21-11)17-6-8-20-7-5-10(2)3/h9-10H,4-8H2,1-3H3,(H,17,18,19) |
| InChIKey | PIOIVWPAILEBOR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|