C11H10ClF4N3S — CID 106293411
2-chloro-6-ethyl-N-(2,2,3,3-tetrafluoropropyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 106293411) has the molecular formula C11H10ClF4N3S and a molecular weight of 327.73 g/mol. Its IUPAC name is 2-chloro-6-ethyl-N-(2,2,3,3-tetrafluoropropyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-ethyl-N-(2,2,3,3-tetrafluoropropyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106293411 |
| Molecular Formula | C11H10ClF4N3S |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-chloro-6-ethyl-N-(2,2,3,3-tetrafluoropropyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NCC(F)(F)C(F)F)nc(Cl)nc2s1 |
| InChI | InChI=1S/C11H10ClF4N3S/c1-2-5-3-6-7(17-4-11(15,16)9(13)14)18-10(12)19-8(6)20-5/h3,9H,2,4H2,1H3,(H,17,18,19) |
| InChIKey | GLNZYSNKZZPXNS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|