C16H16ClN3OS — CID 82066376
4-[2-[(2-chloro-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]phenol (PubChem CID 82066376) has the molecular formula C16H16ClN3OS and a molecular weight of 333.84 g/mol. Its IUPAC name is 4-[2-[(2-chloro-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]phenol.
| Compound Name | 4-[2-[(2-chloro-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 82066376 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 4-[2-[(2-chloro-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]phenol |
| SMILES | CCc1cc2c(NCCc3ccc(O)cc3)nc(Cl)nc2s1 |
| InChI | InChI=1S/C16H16ClN3OS/c1-2-12-9-13-14(19-16(17)20-15(13)22-12)18-8-7-10-3-5-11(21)6-4-10/h3-6,9,21H,2,7-8H2,1H3,(H,18,19,20) |
| InChIKey | IHHILTSMOOYKLP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |