C17H19N3OS — CID 11645321
4-[2-[(6-propylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]phenol (PubChem CID 11645321) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is 4-[2-[(6-propylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]phenol.
| Compound Name | 4-[2-[(6-propylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 11645321 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-[2-[(6-propylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]phenol |
| SMILES | CCCc1cc2c(NCCc3ccc(O)cc3)ncnc2s1 |
| InChI | InChI=1S/C17H19N3OS/c1-2-3-14-10-15-16(19-11-20-17(15)22-14)18-9-8-12-4-6-13(21)7-5-12/h4-7,10-11,21H,2-3,8-9H2,1H3,(H,18,19,20) |
| InChIKey | JHVQRPLYPXMOEX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |