C11H12N3O2S- — CID 6957125
3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate (PubChem CID 6957125) has the molecular formula C11H12N3O2S- and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate.
| Compound Name | 3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 6957125 |
| Molecular Formula | C11H12N3O2S- |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]propanoate |
| SMILES | CCc1cc2c(NCCC(=O)[O-])ncnc2s1 |
| InChI | InChI=1S/C11H13N3O2S/c1-2-7-5-8-10(12-4-3-9(15)16)13-6-14-11(8)17-7/h5-6H,2-4H2,1H3,(H,15,16)(H,12,13,14)/p-1 |
| InChIKey | FRKLHYPYUBUYJK-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |