C14H20N4O2S — CID 39084926
2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(3-methoxypropyl)acetamide (PubChem CID 39084926) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 39084926 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(3-methoxypropyl)acetamide |
| SMILES | CCc1cc2c(NCC(=O)NCCCOC)ncnc2s1 |
| InChI | InChI=1S/C14H20N4O2S/c1-3-10-7-11-13(17-9-18-14(11)21-10)16-8-12(19)15-5-4-6-20-2/h7,9H,3-6,8H2,1-2H3,(H,15,19)(H,16,17,18) |
| InChIKey | NFPRDMVHBMCLHE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|