C13H17ClN4O2S — CID 103322382
2-[(2-chloro-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 103322382) has the molecular formula C13H17ClN4O2S and a molecular weight of 328.83 g/mol. Its IUPAC name is 2-[(2-chloro-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2-chloro-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 103322382 |
| Molecular Formula | C13H17ClN4O2S |
| Molecular Weight | 328.83 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-[(2-chloro-6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCc1cc2c(NCC(=O)NCCOC)nc(Cl)nc2s1 |
| InChI | InChI=1S/C13H17ClN4O2S/c1-3-8-6-9-11(17-13(14)18-12(9)21-8)16-7-10(19)15-4-5-20-2/h6H,3-5,7H2,1-2H3,(H,15,19)(H,16,17,18) |
| InChIKey | WGXKAAVPXKRKPW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.83 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|