C11H14N4O2S — CID 9453782
N-(2-methoxyethyl)-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide (PubChem CID 9453782) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide |
|---|---|
| PubChem CID | 9453782 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-(2-methoxyethyl)-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide |
| SMILES | COCCNC(=O)CNc1ncnc2sccc12 |
| InChI | InChI=1S/C11H14N4O2S/c1-17-4-3-12-9(16)6-13-10-8-2-5-18-11(8)15-7-14-10/h2,5,7H,3-4,6H2,1H3,(H,12,16)(H,13,14,15) |
| InChIKey | HWUAPCCTOWVQRZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|