C11H15N3OS — CID 62735152
N-(4-methoxybutan-2-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 62735152) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is N-(4-methoxybutan-2-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(4-methoxybutan-2-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 62735152 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | N-(4-methoxybutan-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COCCC(C)Nc1ncnc2sccc12 |
| InChI | InChI=1S/C11H15N3OS/c1-8(3-5-15-2)14-10-9-4-6-16-11(9)13-7-12-10/h4,6-8H,3,5H2,1-2H3,(H,12,13,14) |
| InChIKey | WOHLEUOGDHLBNL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |