C11H13N3O2S — CID 93263493
(2R)-3-methyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)butanoic acid (PubChem CID 93263493) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is (2R)-3-methyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)butanoic acid.
| Compound Name | (2R)-3-methyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 93263493 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | (2R)-3-methyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)butanoic acid |
| SMILES | CC(C)[C@@H](Nc1ncnc2sccc12)C(=O)O |
| InChI | InChI=1S/C11H13N3O2S/c1-6(2)8(11(15)16)14-9-7-3-4-17-10(7)13-5-12-9/h3-6,8H,1-2H3,(H,15,16)(H,12,13,14)/t8-/m1/s1 |
| InChIKey | DZWRXRHBDTYOJP-MRVPVSSYSA-N |
| XLogP | 2.21 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |