C20H16N4OS — CID 94546891
(2S)-N,2-diphenyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide (PubChem CID 94546891) has the molecular formula C20H16N4OS and a molecular weight of 360.44 g/mol. Its IUPAC name is (2S)-N,2-diphenyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide.
| Compound Name | (2S)-N,2-diphenyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide |
|---|---|
| PubChem CID | 94546891 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (2S)-N,2-diphenyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)acetamide |
| SMILES | O=C(Nc1ccccc1)[C@@H](Nc1ncnc2sccc12)c1ccccc1 |
| InChI | InChI=1S/C20H16N4OS/c25-19(23-15-9-5-2-6-10-15)17(14-7-3-1-4-8-14)24-18-16-11-12-26-20(16)22-13-21-18/h1-13,17H,(H,23,25)(H,21,22,24)/t17-/m0/s1 |
| InChIKey | IAXFCPQMJSGNJG-KRWDZBQOSA-N |
| XLogP | 4.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |