C17H13N3OS — CID 9450827
N-[(S)-furan-2-yl(phenyl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 9450827) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is N-[(S)-furan-2-yl(phenyl)methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(S)-furan-2-yl(phenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 9450827 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-[(S)-furan-2-yl(phenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc([C@H](Nc2ncnc3sccc23)c2ccco2)cc1 |
| InChI | InChI=1S/C17H13N3OS/c1-2-5-12(6-3-1)15(14-7-4-9-21-14)20-16-13-8-10-22-17(13)19-11-18-16/h1-11,15H,(H,18,19,20)/t15-/m0/s1 |
| InChIKey | PDSRWQKNANIQQS-HNNXBMFYSA-N |
| XLogP | 4.49 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |