C16H15N3S — CID 41332400
N-[(R)-cyclopropyl(phenyl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 41332400) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-[(R)-cyclopropyl(phenyl)methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(R)-cyclopropyl(phenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 41332400 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[(R)-cyclopropyl(phenyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc([C@H](Nc2ncnc3sccc23)C2CC2)cc1 |
| InChI | InChI=1S/C16H15N3S/c1-2-4-11(5-3-1)14(12-6-7-12)19-15-13-8-9-20-16(13)18-10-17-15/h1-5,8-10,12,14H,6-7H2,(H,17,18,19)/t14-/m0/s1 |
| InChIKey | XGFPEJYRJJHTQY-AWEZNQCLSA-N |
| XLogP | 4.25 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |