C20H15N3OS — CID 7615397
2,2-diphenyl-N-thieno[2,3-d]pyrimidin-4-ylacetamide (PubChem CID 7615397) has the molecular formula C20H15N3OS and a molecular weight of 345.43 g/mol. Its IUPAC name is 2,2-diphenyl-N-thieno[2,3-d]pyrimidin-4-ylacetamide.
| Compound Name | 2,2-diphenyl-N-thieno[2,3-d]pyrimidin-4-ylacetamide |
|---|---|
| PubChem CID | 7615397 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2,2-diphenyl-N-thieno[2,3-d]pyrimidin-4-ylacetamide |
| SMILES | O=C(Nc1ncnc2sccc12)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15N3OS/c24-19(23-18-16-11-12-25-20(16)22-13-21-18)17(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,17H,(H,21,22,23,24) |
| InChIKey | SWUIRRUIXYJEJB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |