C11H13N3O2S — CID 43631382
2-(thieno[2,3-d]pyrimidin-4-ylamino)pentanoic acid (PubChem CID 43631382) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-(thieno[2,3-d]pyrimidin-4-ylamino)pentanoic acid.
| Compound Name | 2-(thieno[2,3-d]pyrimidin-4-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 43631382 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-(thieno[2,3-d]pyrimidin-4-ylamino)pentanoic acid |
| SMILES | CCCC(Nc1ncnc2sccc12)C(=O)O |
| InChI | InChI=1S/C11H13N3O2S/c1-2-3-8(11(15)16)14-9-7-4-5-17-10(7)13-6-12-9/h4-6,8H,2-3H2,1H3,(H,15,16)(H,12,13,14) |
| InChIKey | KIETZYFJRSOIDP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |