C17H17N3O2S — CID 7615356
4-butoxy-N-thieno[2,3-d]pyrimidin-4-ylbenzamide (PubChem CID 7615356) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-butoxy-N-thieno[2,3-d]pyrimidin-4-ylbenzamide.
| Compound Name | 4-butoxy-N-thieno[2,3-d]pyrimidin-4-ylbenzamide |
|---|---|
| PubChem CID | 7615356 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-butoxy-N-thieno[2,3-d]pyrimidin-4-ylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C17H17N3O2S/c1-2-3-9-22-13-6-4-12(5-7-13)16(21)20-15-14-8-10-23-17(14)19-11-18-15/h4-8,10-11H,2-3,9H2,1H3,(H,18,19,20,21) |
| InChIKey | HBVQHWHWHVFCEG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|