C15H14N4O3S2 — CID 7615360
4-(dimethylsulfamoyl)-N-thieno[2,3-d]pyrimidin-4-ylbenzamide (PubChem CID 7615360) has the molecular formula C15H14N4O3S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-thieno[2,3-d]pyrimidin-4-ylbenzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-thieno[2,3-d]pyrimidin-4-ylbenzamide |
|---|---|
| PubChem CID | 7615360 |
| Molecular Formula | C15H14N4O3S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-thieno[2,3-d]pyrimidin-4-ylbenzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C15H14N4O3S2/c1-19(2)24(21,22)11-5-3-10(4-6-11)14(20)18-13-12-7-8-23-15(12)17-9-16-13/h3-9H,1-2H3,(H,16,17,18,20) |
| InChIKey | XIFSSCONTJASPG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |