C18H24N6O3S — CID 90543760
4-(dimethylsulfamoyl)-N-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]benzamide (PubChem CID 90543760) has the molecular formula C18H24N6O3S and a molecular weight of 404.50 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 90543760 |
| Molecular Formula | C18H24N6O3S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]benzamide |
| SMILES | CN1CCN(c2cc(NC(=O)c3ccc(S(=O)(=O)N(C)C)cc3)ncn2)CC1 |
| InChI | InChI=1S/C18H24N6O3S/c1-22(2)28(26,27)15-6-4-14(5-7-15)18(25)21-16-12-17(20-13-19-16)24-10-8-23(3)9-11-24/h4-7,12-13H,8-11H2,1-3H3,(H,19,20,21,25) |
| InChIKey | VAMLJPIXRYXXBJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |