C16H17IN4O — CID 90544651
4-iodo-N-(6-piperidin-1-ylpyrimidin-4-yl)benzamide (PubChem CID 90544651) has the molecular formula C16H17IN4O and a molecular weight of 408.24 g/mol. Its IUPAC name is 4-iodo-N-(6-piperidin-1-ylpyrimidin-4-yl)benzamide.
| Compound Name | 4-iodo-N-(6-piperidin-1-ylpyrimidin-4-yl)benzamide |
|---|---|
| PubChem CID | 90544651 |
| Molecular Formula | C16H17IN4O |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 4-iodo-N-(6-piperidin-1-ylpyrimidin-4-yl)benzamide |
| SMILES | O=C(Nc1cc(N2CCCCC2)ncn1)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H17IN4O/c17-13-6-4-12(5-7-13)16(22)20-14-10-15(19-11-18-14)21-8-2-1-3-9-21/h4-7,10-11H,1-3,8-9H2,(H,18,19,20,22) |
| InChIKey | JLNRRFGWFYWNLH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|