C16H17N5O3 — CID 90544457
3-nitro-N-(6-piperidin-1-ylpyrimidin-4-yl)benzamide (PubChem CID 90544457) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 3-nitro-N-(6-piperidin-1-ylpyrimidin-4-yl)benzamide.
| Compound Name | 3-nitro-N-(6-piperidin-1-ylpyrimidin-4-yl)benzamide |
|---|---|
| PubChem CID | 90544457 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-nitro-N-(6-piperidin-1-ylpyrimidin-4-yl)benzamide |
| SMILES | O=C(Nc1cc(N2CCCCC2)ncn1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17N5O3/c22-16(12-5-4-6-13(9-12)21(23)24)19-14-10-15(18-11-17-14)20-7-2-1-3-8-20/h4-6,9-11H,1-3,7-8H2,(H,17,18,19,22) |
| InChIKey | CVUCIGZFMFDVSU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|