C15H17N5O4S — CID 90544119
N-(6-morpholin-4-ylpyrimidin-4-yl)-4-sulfamoylbenzamide (PubChem CID 90544119) has the molecular formula C15H17N5O4S and a molecular weight of 363.40 g/mol. Its IUPAC name is N-(6-morpholin-4-ylpyrimidin-4-yl)-4-sulfamoylbenzamide.
| Compound Name | N-(6-morpholin-4-ylpyrimidin-4-yl)-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 90544119 |
| Molecular Formula | C15H17N5O4S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-(6-morpholin-4-ylpyrimidin-4-yl)-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)Nc2cc(N3CCOCC3)ncn2)cc1 |
| InChI | InChI=1S/C15H17N5O4S/c16-25(22,23)12-3-1-11(2-4-12)15(21)19-13-9-14(18-10-17-13)20-5-7-24-8-6-20/h1-4,9-10H,5-8H2,(H2,16,22,23)(H,17,18,19,21) |
| InChIKey | HAPLIFMVVREIGI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |