C15H14Cl2N4O2 — CID 90544249
3,5-dichloro-N-(6-morpholin-4-ylpyrimidin-4-yl)benzamide (PubChem CID 90544249) has the molecular formula C15H14Cl2N4O2 and a molecular weight of 353.21 g/mol. Its IUPAC name is 3,5-dichloro-N-(6-morpholin-4-ylpyrimidin-4-yl)benzamide.
| Compound Name | 3,5-dichloro-N-(6-morpholin-4-ylpyrimidin-4-yl)benzamide |
|---|---|
| PubChem CID | 90544249 |
| Molecular Formula | C15H14Cl2N4O2 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 3,5-dichloro-N-(6-morpholin-4-ylpyrimidin-4-yl)benzamide |
| SMILES | O=C(Nc1cc(N2CCOCC2)ncn1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N4O2/c16-11-5-10(6-12(17)7-11)15(22)20-13-8-14(19-9-18-13)21-1-3-23-4-2-21/h5-9H,1-4H2,(H,18,19,20,22) |
| InChIKey | BTHYZKXLVFZMJY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |