C15H13N3O3S2 — CID 7615469
4-ethylsulfonyl-N-thieno[2,3-d]pyrimidin-4-ylbenzamide (PubChem CID 7615469) has the molecular formula C15H13N3O3S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-ethylsulfonyl-N-thieno[2,3-d]pyrimidin-4-ylbenzamide.
| Compound Name | 4-ethylsulfonyl-N-thieno[2,3-d]pyrimidin-4-ylbenzamide |
|---|---|
| PubChem CID | 7615469 |
| Molecular Formula | C15H13N3O3S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 4-ethylsulfonyl-N-thieno[2,3-d]pyrimidin-4-ylbenzamide |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)Nc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C15H13N3O3S2/c1-2-23(20,21)11-5-3-10(4-6-11)14(19)18-13-12-7-8-22-15(12)17-9-16-13/h3-9H,2H2,1H3,(H,16,17,18,19) |
| InChIKey | JYSWGIRICCZTPU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |