C14H12Br2N2O3S — CID 71853902
N-(5,6-dibromo-3-pyridinyl)-4-ethylsulfonylbenzamide (PubChem CID 71853902) has the molecular formula C14H12Br2N2O3S and a molecular weight of 448.14 g/mol. Its IUPAC name is N-(5,6-dibromo-3-pyridinyl)-4-ethylsulfonylbenzamide.
| Compound Name | N-(5,6-dibromo-3-pyridinyl)-4-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 71853902 |
| Molecular Formula | C14H12Br2N2O3S |
| Molecular Weight | 448.14 g/mol |
| Exact Mass | 445.89 |
| IUPAC Name | N-(5,6-dibromo-3-pyridinyl)-4-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)Nc2cnc(Br)c(Br)c2)cc1 |
| InChI | InChI=1S/C14H12Br2N2O3S/c1-2-22(20,21)11-5-3-9(4-6-11)14(19)18-10-7-12(15)13(16)17-8-10/h3-8H,2H2,1H3,(H,18,19) |
| InChIKey | WVLDDYHDFBQUCL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.14 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|