C13H12BrNO4S — CID 106853117
2-bromo-N-(4-ethylsulfonylphenyl)furan-3-carboxamide (PubChem CID 106853117) has the molecular formula C13H12BrNO4S and a molecular weight of 358.21 g/mol. Its IUPAC name is 2-bromo-N-(4-ethylsulfonylphenyl)furan-3-carboxamide.
| Compound Name | 2-bromo-N-(4-ethylsulfonylphenyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106853117 |
| Molecular Formula | C13H12BrNO4S |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 2-bromo-N-(4-ethylsulfonylphenyl)furan-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)c2ccoc2Br)cc1 |
| InChI | InChI=1S/C13H12BrNO4S/c1-2-20(17,18)10-5-3-9(4-6-10)15-13(16)11-7-8-19-12(11)14/h3-8H,2H2,1H3,(H,15,16) |
| InChIKey | YKAKVPZYUHHNOR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |