C14H13BrN2O3 — CID 106852888
N-[(4-acetamidophenyl)methyl]-2-bromofuran-3-carboxamide (PubChem CID 106852888) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is N-[(4-acetamidophenyl)methyl]-2-bromofuran-3-carboxamide.
| Compound Name | N-[(4-acetamidophenyl)methyl]-2-bromofuran-3-carboxamide |
|---|---|
| PubChem CID | 106852888 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N-[(4-acetamidophenyl)methyl]-2-bromofuran-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(CNC(=O)c2ccoc2Br)cc1 |
| InChI | InChI=1S/C14H13BrN2O3/c1-9(18)17-11-4-2-10(3-5-11)8-16-14(19)12-6-7-20-13(12)15/h2-7H,8H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | HCUSXAFWCPXBGJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |