C13H11BrClNO2 — CID 106856118
2-bromo-N-[4-(2-chloroethyl)phenyl]furan-3-carboxamide (PubChem CID 106856118) has the molecular formula C13H11BrClNO2 and a molecular weight of 328.59 g/mol. Its IUPAC name is 2-bromo-N-[4-(2-chloroethyl)phenyl]furan-3-carboxamide.
| Compound Name | 2-bromo-N-[4-(2-chloroethyl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106856118 |
| Molecular Formula | C13H11BrClNO2 |
| Molecular Weight | 328.59 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 2-bromo-N-[4-(2-chloroethyl)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1ccc(CCCl)cc1)c1ccoc1Br |
| InChI | InChI=1S/C13H11BrClNO2/c14-12-11(6-8-18-12)13(17)16-10-3-1-9(2-4-10)5-7-15/h1-4,6,8H,5,7H2,(H,16,17) |
| InChIKey | TVYRJYRRZMDDAH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|