C14H16N2O4S — CID 42021822
N-(4-ethylsulfonylphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 42021822) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-(4-ethylsulfonylphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(4-ethylsulfonylphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 42021822 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(4-ethylsulfonylphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)c2c(C)noc2C)cc1 |
| InChI | InChI=1S/C14H16N2O4S/c1-4-21(18,19)12-7-5-11(6-8-12)15-14(17)13-9(2)16-20-10(13)3/h5-8H,4H2,1-3H3,(H,15,17) |
| InChIKey | KOOKPSNUMPIUFF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |