C12H12N2O3 — CID 28780641
N-(4-hydroxyphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 28780641) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 28780641 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | N-(4-hydroxyphenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C12H12N2O3/c1-7-11(8(2)17-14-7)12(16)13-9-3-5-10(15)6-4-9/h3-6,15H,1-2H3,(H,13,16) |
| InChIKey | AKWYUSMQMXFTNI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|