C10H11N3O2S — CID 61265918
2-methyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)propanoic acid (PubChem CID 61265918) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-methyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)propanoic acid.
| Compound Name | 2-methyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)propanoic acid |
|---|---|
| PubChem CID | 61265918 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-methyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)propanoic acid |
| SMILES | CC(C)(Nc1ncnc2sccc12)C(=O)O |
| InChI | InChI=1S/C10H11N3O2S/c1-10(2,9(14)15)13-7-6-3-4-16-8(6)12-5-11-7/h3-5H,1-2H3,(H,14,15)(H,11,12,13) |
| InChIKey | JBELTSDMXZTBSE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |