C11H15N3O2S — CID 103738500
2-ethyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)propane-1,3-diol (PubChem CID 103738500) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 2-ethyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)propane-1,3-diol.
| Compound Name | 2-ethyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 103738500 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-ethyl-2-(thieno[2,3-d]pyrimidin-4-ylamino)propane-1,3-diol |
| SMILES | CCC(CO)(CO)Nc1ncnc2sccc12 |
| InChI | InChI=1S/C11H15N3O2S/c1-2-11(5-15,6-16)14-9-8-3-4-17-10(8)13-7-12-9/h3-4,7,15-16H,2,5-6H2,1H3,(H,12,13,14) |
| InChIKey | PLDNZVHFSHRUHJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |