C14H21N3S — CID 13038312
N-octylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 13038312) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-octylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-octylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 13038312 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-octylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCCCCCNc1ncnc2sccc12 |
| InChI | InChI=1S/C14H21N3S/c1-2-3-4-5-6-7-9-15-13-12-8-10-18-14(12)17-11-16-13/h8,10-11H,2-7,9H2,1H3,(H,15,16,17) |
| InChIKey | WFTGHZFEKFCHSV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|