C11H15N3S2 — CID 115637407
N-(4-methylsulfanylbutyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 115637407) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is N-(4-methylsulfanylbutyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(4-methylsulfanylbutyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 115637407 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-(4-methylsulfanylbutyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CSCCCCNc1ncnc2sccc12 |
| InChI | InChI=1S/C11H15N3S2/c1-15-6-3-2-5-12-10-9-4-7-16-11(9)14-8-13-10/h4,7-8H,2-3,5-6H2,1H3,(H,12,13,14) |
| InChIKey | JHCSRSVGPXZTKX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|