About N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine
N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 67600724) has the molecular formula C11H9BrN4S2
and a molecular weight of 341.26 g/mol. Its IUPAC name is N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 67600724 |
| Molecular Formula | C11H9BrN4S2 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Brc1csc(CCNc2ncnc3sccc23)n1 |
| InChI | InChI=1S/C11H9BrN4S2/c12-8-5-18-9(16-8)1-3-13-10-7-2-4-17-11(7)15-6-14-10/h2,4-6H,1,3H2,(H,13,14,15) |
| InChIKey | UPBSFVXFRSLVEZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine (CID 67600724) is N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine is Brc1csc(CCNc2ncnc3sccc23)n1.
What is the InChIKey of N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is UPBSFVXFRSLVEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrN4S2/c12-8-5-18-9(16-8)1-3-13-10-7-2-4-17-11(7)15-6-14-10/h2,4-6H,1,3H2,(H,13,14,15).
What are the key properties of N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine?
N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 341.26 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-bromo-1,3-thiazol-2-yl)ethyl]thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 67600724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).