C11H13N3S — CID 115628477
N-[(E)-pent-3-enyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 115628477) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[(E)-pent-3-enyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 115628477 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-[(E)-pent-3-enyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | C/C=C/CCNc1ncnc2sccc12 |
| InChI | InChI=1S/C11H13N3S/c1-2-3-4-6-12-10-9-5-7-15-11(9)14-8-13-10/h2-3,5,7-8H,4,6H2,1H3,(H,12,13,14)/b3-2+ |
| InChIKey | BJROYIQALZFMMJ-NSCUHMNNSA-N |
| XLogP | 3.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|