C12H14N2S — CID 115628494
N-[(E)-pent-3-enyl]thieno[3,2-c]pyridin-4-amine (PubChem CID 115628494) has the molecular formula C12H14N2S and a molecular weight of 218.33 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]thieno[3,2-c]pyridin-4-amine.
| Compound Name | N-[(E)-pent-3-enyl]thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 115628494 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | N-[(E)-pent-3-enyl]thieno[3,2-c]pyridin-4-amine |
| SMILES | C/C=C/CCNc1nccc2sccc12 |
| InChI | InChI=1S/C12H14N2S/c1-2-3-4-7-13-12-10-6-9-15-11(10)5-8-14-12/h2-3,5-6,8-9H,4,7H2,1H3,(H,13,14)/b3-2+ |
| InChIKey | NYQYDQHVEDSICJ-NSCUHMNNSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|