C10H11N3OS — CID 43522799
N-methyl-2-(thieno[3,2-c]pyridin-4-ylamino)acetamide (PubChem CID 43522799) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is N-methyl-2-(thieno[3,2-c]pyridin-4-ylamino)acetamide.
| Compound Name | N-methyl-2-(thieno[3,2-c]pyridin-4-ylamino)acetamide |
|---|---|
| PubChem CID | 43522799 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N-methyl-2-(thieno[3,2-c]pyridin-4-ylamino)acetamide |
| SMILES | CNC(=O)CNc1nccc2sccc12 |
| InChI | InChI=1S/C10H11N3OS/c1-11-9(14)6-13-10-7-3-5-15-8(7)2-4-12-10/h2-5H,6H2,1H3,(H,11,14)(H,12,13) |
| InChIKey | BOCQUCWSCVJGMJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |