C10H9ClN2S — CID 115637285
N-(2-chloroprop-2-enyl)thieno[3,2-c]pyridin-4-amine (PubChem CID 115637285) has the molecular formula C10H9ClN2S and a molecular weight of 224.72 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)thieno[3,2-c]pyridin-4-amine.
| Compound Name | N-(2-chloroprop-2-enyl)thieno[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 115637285 |
| Molecular Formula | C10H9ClN2S |
| Molecular Weight | 224.72 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | N-(2-chloroprop-2-enyl)thieno[3,2-c]pyridin-4-amine |
| SMILES | C=C(Cl)CNc1nccc2sccc12 |
| InChI | InChI=1S/C10H9ClN2S/c1-7(11)6-13-10-8-3-5-14-9(8)2-4-12-10/h2-5H,1,6H2,(H,12,13) |
| InChIKey | KBLIWUSETVENPO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.72 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |