C15H20N2OS — CID 112697561
[1-[(thieno[3,2-c]pyridin-4-ylamino)methyl]cyclohexyl]methanol (PubChem CID 112697561) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is [1-[(thieno[3,2-c]pyridin-4-ylamino)methyl]cyclohexyl]methanol.
| Compound Name | [1-[(thieno[3,2-c]pyridin-4-ylamino)methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 112697561 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [1-[(thieno[3,2-c]pyridin-4-ylamino)methyl]cyclohexyl]methanol |
| SMILES | OCC1(CNc2nccc3sccc23)CCCCC1 |
| InChI | InChI=1S/C15H20N2OS/c18-11-15(6-2-1-3-7-15)10-17-14-12-5-9-19-13(12)4-8-16-14/h4-5,8-9,18H,1-3,6-7,10-11H2,(H,16,17) |
| InChIKey | JDDWGROOYOXORY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |